C9H18O — CID 121477247
(2S,3R)-3-methyl-2-propan-2-yloxane (PubChem CID 121477247) has the molecular formula C9H18O and a molecular weight of 142.24 g/mol. Its IUPAC name is (2S,3R)-3-methyl-2-propan-2-yloxane.
| Compound Name | (2S,3R)-3-methyl-2-propan-2-yloxane |
|---|---|
| PubChem CID | 121477247 |
| Molecular Formula | C9H18O |
| Molecular Weight | 142.24 g/mol |
| Exact Mass | 142.14 |
| IUPAC Name | (2S,3R)-3-methyl-2-propan-2-yloxane |
| SMILES | CC(C)[C@@H]1OCCC[C@H]1C |
| InChI | InChI=1S/C9H18O/c1-7(2)9-8(3)5-4-6-10-9/h7-9H,4-6H2,1-3H3/t8-,9+/m1/s1 |
| InChIKey | NCUQRIHAJRCKQZ-BDAKNGLRSA-N |
| XLogP | 2.46 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.24 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |