C16H28O3 — CID 166892307
(4'aS,8'aR)-2'-ethyl-4'a,8',8'-trimethylspiro[1,3-dioxolane-2,7'-2,3,4,5,6,8a-hexahydrochromene] (PubChem CID 166892307) has the molecular formula C16H28O3 and a molecular weight of 268.40 g/mol. Its IUPAC name is (4'aS,8'aR)-2'-ethyl-4'a,8',8'-trimethylspiro[1,3-dioxolane-2,7'-2,3,4,5,6,8a-hexahydrochromene].
| Compound Name | (4'aS,8'aR)-2'-ethyl-4'a,8',8'-trimethylspiro[1,3-dioxolane-2,7'-2,3,4,5,6,8a-hexahydrochromene] |
|---|---|
| PubChem CID | 166892307 |
| Molecular Formula | C16H28O3 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.20 |
| IUPAC Name | (4'aS,8'aR)-2'-ethyl-4'a,8',8'-trimethylspiro[1,3-dioxolane-2,7'-2,3,4,5,6,8a-hexahydrochromene] |
| SMILES | CCC1CC[C@@]2(C)CCC3(OCCO3)C(C)(C)[C@@H]2O1 |
| InChI | InChI=1S/C16H28O3/c1-5-12-6-7-15(4)8-9-16(17-10-11-18-16)14(2,3)13(15)19-12/h12-13H,5-11H2,1-4H3/t12?,13-,15-/m0/s1 |
| InChIKey | SPEDNWNQUOHONW-MHEXWIEDSA-N |
| XLogP | 3.51 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |