C16H28O3 — CID 166892312
(2S,4aS,8aR)-7-hydroxy-4a,8,8-trimethyl-2-propan-2-yl-3,4,5,6,7,8a-hexahydro-2H-chromene-6-carbaldehyde (PubChem CID 166892312) has the molecular formula C16H28O3 and a molecular weight of 268.40 g/mol. Its IUPAC name is (2S,4aS,8aR)-7-hydroxy-4a,8,8-trimethyl-2-propan-2-yl-3,4,5,6,7,8a-hexahydro-2H-chromene-6-carbaldehyde.
| Compound Name | (2S,4aS,8aR)-7-hydroxy-4a,8,8-trimethyl-2-propan-2-yl-3,4,5,6,7,8a-hexahydro-2H-chromene-6-carbaldehyde |
|---|---|
| PubChem CID | 166892312 |
| Molecular Formula | C16H28O3 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.20 |
| IUPAC Name | (2S,4aS,8aR)-7-hydroxy-4a,8,8-trimethyl-2-propan-2-yl-3,4,5,6,7,8a-hexahydro-2H-chromene-6-carbaldehyde |
| SMILES | CC(C)[C@@H]1CC[C@@]2(C)CC(C=O)C(O)C(C)(C)[C@@H]2O1 |
| InChI | InChI=1S/C16H28O3/c1-10(2)12-6-7-16(5)8-11(9-17)13(18)15(3,4)14(16)19-12/h9-14,18H,6-8H2,1-5H3/t11?,12-,13?,14-,16-/m0/s1 |
| InChIKey | ZFNZPNMHNRSCGD-QLBVWECGSA-N |
| XLogP | 2.80 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|