C12H20O3 — CID 135272626
2-hydroxy-4a,8,8-trimethyl-2,3,4,5,6,8a-hexahydrochromen-7-one (PubChem CID 135272626) has the molecular formula C12H20O3 and a molecular weight of 212.29 g/mol. Its IUPAC name is 2-hydroxy-4a,8,8-trimethyl-2,3,4,5,6,8a-hexahydrochromen-7-one.
| Compound Name | 2-hydroxy-4a,8,8-trimethyl-2,3,4,5,6,8a-hexahydrochromen-7-one |
|---|---|
| PubChem CID | 135272626 |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | 2-hydroxy-4a,8,8-trimethyl-2,3,4,5,6,8a-hexahydrochromen-7-one |
| SMILES | CC12CCC(=O)C(C)(C)C1OC(O)CC2 |
| InChI | InChI=1S/C12H20O3/c1-11(2)8(13)4-6-12(3)7-5-9(14)15-10(11)12/h9-10,14H,4-7H2,1-3H3 |
| InChIKey | QKEBQAJOGIFESY-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |