C8H14O2 — CID 10997135
3-(hydroxymethyl)-2,2-dimethylcyclopentan-1-one (PubChem CID 10997135) has the molecular formula C8H14O2 and a molecular weight of 142.20 g/mol. Its IUPAC name is 3-(hydroxymethyl)-2,2-dimethylcyclopentan-1-one.
| Compound Name | 3-(hydroxymethyl)-2,2-dimethylcyclopentan-1-one |
|---|---|
| PubChem CID | 10997135 |
| Molecular Formula | C8H14O2 |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.10 |
| IUPAC Name | 3-(hydroxymethyl)-2,2-dimethylcyclopentan-1-one |
| SMILES | CC1(C)C(=O)CCC1CO |
| InChI | InChI=1S/C8H14O2/c1-8(2)6(5-9)3-4-7(8)10/h6,9H,3-5H2,1-2H3 |
| InChIKey | OJBIHPPOOFJQOO-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |