C15H24O2 — CID 162623235
(1S,2R,7R,8R,9S)-8-hydroxy-2,6,6,9-tetramethyltricyclo[5.4.0.02,9]undecan-5-one (PubChem CID 162623235) has the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. Its IUPAC name is (1S,2R,7R,8R,9S)-8-hydroxy-2,6,6,9-tetramethyltricyclo[5.4.0.02,9]undecan-5-one.
| Compound Name | (1S,2R,7R,8R,9S)-8-hydroxy-2,6,6,9-tetramethyltricyclo[5.4.0.02,9]undecan-5-one |
|---|---|
| PubChem CID | 162623235 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | (1S,2R,7R,8R,9S)-8-hydroxy-2,6,6,9-tetramethyltricyclo[5.4.0.02,9]undecan-5-one |
| SMILES | CC1(C)C(=O)CC[C@]2(C)[C@H]3CC[C@]2(C)[C@H](O)[C@H]31 |
| InChI | InChI=1S/C15H24O2/c1-13(2)10(16)6-8-14(3)9-5-7-15(14,4)12(17)11(9)13/h9,11-12,17H,5-8H2,1-4H3/t9-,11-,12+,14+,15+/m0/s1 |
| InChIKey | UFRXLBSBVNJZNP-PRHQYYMVSA-N |
| XLogP | 2.79 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |