C15H20O5 — CID 124827147
(5S,5aS,9aR,9bR)-5,9b-dihydroxy-6,6,9a-trimethyl-5,5a,8,9-tetrahydro-3H-benzo[g][2]benzofuran-1,7-dione (PubChem CID 124827147) has the molecular formula C15H20O5 and a molecular weight of 280.32 g/mol. Its IUPAC name is (5S,5aS,9aR,9bR)-5,9b-dihydroxy-6,6,9a-trimethyl-5,5a,8,9-tetrahydro-3H-benzo[g][2]benzofuran-1,7-dione.
| Compound Name | (5S,5aS,9aR,9bR)-5,9b-dihydroxy-6,6,9a-trimethyl-5,5a,8,9-tetrahydro-3H-benzo[g][2]benzofuran-1,7-dione |
|---|---|
| PubChem CID | 124827147 |
| Molecular Formula | C15H20O5 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | (5S,5aS,9aR,9bR)-5,9b-dihydroxy-6,6,9a-trimethyl-5,5a,8,9-tetrahydro-3H-benzo[g][2]benzofuran-1,7-dione |
| SMILES | CC1(C)C(=O)CC[C@]2(C)[C@@H]1[C@@H](O)C=C1COC(=O)[C@]12O |
| InChI | InChI=1S/C15H20O5/c1-13(2)10(17)4-5-14(3)11(13)9(16)6-8-7-20-12(18)15(8,14)19/h6,9,11,16,19H,4-5,7H2,1-3H3/t9-,11+,14+,15+/m0/s1 |
| InChIKey | GRRDEVSJWVNFRW-FOOGCRFISA-N |
| XLogP | 0.59 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|