C28H50O3Si2 — CID 22873861
cis-(3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-4-cyclohexylbut-1-ynyl]-2-methylidenecyclopentan-1-one (PubChem CID 22873861) has the molecular formula C28H50O3Si2 and a molecular weight of 490.88 g/mol. Its IUPAC name is cis-(3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-4-cyclohexylbut-1-ynyl]-2-methylidenecyclopentan-1-one.
| Compound Name | cis-(3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-4-cyclohexylbut-1-ynyl]-2-methylidenecyclopentan-1-one |
|---|---|
| PubChem CID | 22873861 |
| Molecular Formula | C28H50O3Si2 |
| Molecular Weight | 490.88 g/mol |
| Exact Mass | 490.33 |
| IUPAC Name | cis-(3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-4-cyclohexylbut-1-ynyl]-2-methylidenecyclopentan-1-one |
| SMILES | C=C1C(=O)C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1C#C[C@H](CC1CCCCC1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H50O3Si2/c1-21-24(26(20-25(21)29)31-33(10,11)28(5,6)7)18-17-23(19-22-15-13-12-14-16-22)30-32(8,9)27(2,3)4/h22-24,26H,1,12-16,19-20H2,2-11H3/t23-,24-,26-/m1/s1 |
| InChIKey | IZVRXJPTEVCVMK-DGWZTRNLSA-N |
| XLogP | 7.89 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.88 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|