C14H29NO2Si — CID 11780641
(4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-(2-methylpropyl)pyrrolidin-2-one (PubChem CID 11780641) has the molecular formula C14H29NO2Si and a molecular weight of 271.48 g/mol. Its IUPAC name is (4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-(2-methylpropyl)pyrrolidin-2-one.
| Compound Name | (4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-(2-methylpropyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 11780641 |
| Molecular Formula | C14H29NO2Si |
| Molecular Weight | 271.48 g/mol |
| Exact Mass | 271.20 |
| IUPAC Name | (4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-(2-methylpropyl)pyrrolidin-2-one |
| SMILES | CC(C)C[C@H]1NC(=O)C[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H29NO2Si/c1-10(2)8-11-12(9-13(16)15-11)17-18(6,7)14(3,4)5/h10-12H,8-9H2,1-7H3,(H,15,16)/t11-,12+/m1/s1 |
| InChIKey | UOKQUYNQMHTYCR-NEPJUHHUSA-N |
| XLogP | 3.31 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.48 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|