C14H26ClNO2Si — CID 100991416
(4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-[2-(chloromethyl)prop-2-enyl]pyrrolidin-2-one (PubChem CID 100991416) has the molecular formula C14H26ClNO2Si and a molecular weight of 303.91 g/mol. Its IUPAC name is (4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-[2-(chloromethyl)prop-2-enyl]pyrrolidin-2-one.
| Compound Name | (4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-[2-(chloromethyl)prop-2-enyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 100991416 |
| Molecular Formula | C14H26ClNO2Si |
| Molecular Weight | 303.91 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | (4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-[2-(chloromethyl)prop-2-enyl]pyrrolidin-2-one |
| SMILES | C=C(CCl)C[C@@H]1NC(=O)C[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H26ClNO2Si/c1-10(9-15)7-11-12(8-13(17)16-11)18-19(5,6)14(2,3)4/h11-12H,1,7-9H2,2-6H3,(H,16,17)/t11-,12-/m0/s1 |
| InChIKey | LZSVXLUPZAJQSF-RYUDHWBXSA-N |
| XLogP | 3.45 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.91 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|