C39H74O4SSi3 — CID 11983899
1-[4-[(4R,5R)-2,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-3-cyclohexylprop-1-ynyl]cyclopenten-1-yl]butylsulfanyl]propan-2-one (PubChem CID 11983899) has the molecular formula C39H74O4SSi3 and a molecular weight of 723.34 g/mol. Its IUPAC name is 1-[4-[(4R,5R)-2,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-3-cyclohexylprop-1-ynyl]cyclopenten-1-yl]butylsulfanyl]propan-2-one.
| Compound Name | 1-[4-[(4R,5R)-2,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-3-cyclohexylprop-1-ynyl]cyclopenten-1-yl]butylsulfanyl]propan-2-one |
|---|---|
| PubChem CID | 11983899 |
| Molecular Formula | C39H74O4SSi3 |
| Molecular Weight | 723.34 g/mol |
| Exact Mass | 722.46 |
| IUPAC Name | 1-[4-[(4R,5R)-2,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-3-cyclohexylprop-1-ynyl]cyclopenten-1-yl]butylsulfanyl]propan-2-one |
| SMILES | CC(=O)CSCCCCC1=C(O[Si](C)(C)C(C)(C)C)C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1C#C[C@@H](O[Si](C)(C)C(C)(C)C)C1CCCCC1 |
| InChI | InChI=1S/C39H74O4SSi3/c1-30(40)29-44-27-21-20-24-32-33(25-26-34(31-22-18-17-19-23-31)41-45(11,12)37(2,3)4)36(43-47(15,16)39(8,9)10)28-35(32)42-46(13,14)38(5,6)7/h31,33-34,36H,17-24,27-29H2,1-16H3/t33-,34-,36-/m1/s1 |
| InChIKey | YBQZUPHDFYSLTE-LHZFNVEGSA-N |
| XLogP | 12.14 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.34 |
| LogP ≤ 5 | 12.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|