C8H16O7P2 — CID 159109458
2,6-dihydroxy-3,5,7a,8,9,10,11,11a-octahydrobenzo[h][1,4,7,2,6]trioxadiphosphonine 2,6-dioxide (PubChem CID 159109458) has the molecular formula C8H16O7P2 and a molecular weight of 286.16 g/mol. Its IUPAC name is 2,6-dihydroxy-3,5,7a,8,9,10,11,11a-octahydrobenzo[h][1,4,7,2,6]trioxadiphosphonine 2,6-dioxide.
| Compound Name | 2,6-dihydroxy-3,5,7a,8,9,10,11,11a-octahydrobenzo[h][1,4,7,2,6]trioxadiphosphonine 2,6-dioxide |
|---|---|
| PubChem CID | 159109458 |
| Molecular Formula | C8H16O7P2 |
| Molecular Weight | 286.16 g/mol |
| Exact Mass | 286.04 |
| IUPAC Name | 2,6-dihydroxy-3,5,7a,8,9,10,11,11a-octahydrobenzo[h][1,4,7,2,6]trioxadiphosphonine 2,6-dioxide |
| SMILES | O=P1(O)COCP(=O)(O)OC2CCCCC2O1 |
| InChI | InChI=1S/C8H16O7P2/c9-16(10)5-13-6-17(11,12)15-8-4-2-1-3-7(8)14-16/h7-8H,1-6H2,(H,9,10)(H,11,12) |
| InChIKey | VRHLSVZUZPYXDV-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.16 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|