C9H17O4P — CID 144952769
2-hydroxy-6-(5-methyloxolan-2-yl)-1,2λ5-oxaphosphinane 2-oxide (PubChem CID 144952769) has the molecular formula C9H17O4P and a molecular weight of 220.20 g/mol. Its IUPAC name is 2-hydroxy-6-(5-methyloxolan-2-yl)-1,2λ5-oxaphosphinane 2-oxide.
| Compound Name | 2-hydroxy-6-(5-methyloxolan-2-yl)-1,2λ5-oxaphosphinane 2-oxide |
|---|---|
| PubChem CID | 144952769 |
| Molecular Formula | C9H17O4P |
| Molecular Weight | 220.20 g/mol |
| Exact Mass | 220.09 |
| IUPAC Name | 2-hydroxy-6-(5-methyloxolan-2-yl)-1,2λ5-oxaphosphinane 2-oxide |
| SMILES | CC1CCC(C2CCCP(=O)(O)O2)O1 |
| InChI | InChI=1S/C9H17O4P/c1-7-4-5-8(12-7)9-3-2-6-14(10,11)13-9/h7-9H,2-6H2,1H3,(H,10,11) |
| InChIKey | ILVIMUWCSATKPZ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.20 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|