C6H10FO3P — CID 163692288
2-fluoro-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]dioxaphosphole 2-oxide (PubChem CID 163692288) has the molecular formula C6H10FO3P and a molecular weight of 180.11 g/mol. Its IUPAC name is 2-fluoro-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]dioxaphosphole 2-oxide.
| Compound Name | 2-fluoro-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]dioxaphosphole 2-oxide |
|---|---|
| PubChem CID | 163692288 |
| Molecular Formula | C6H10FO3P |
| Molecular Weight | 180.11 g/mol |
| Exact Mass | 180.04 |
| IUPAC Name | 2-fluoro-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]dioxaphosphole 2-oxide |
| SMILES | O=P1(F)OC2CCCCC2O1 |
| InChI | InChI=1S/C6H10FO3P/c7-11(8)9-5-3-1-2-4-6(5)10-11/h5-6H,1-4H2 |
| InChIKey | JTZISDIMEQINMX-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.11 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|