C6H10FO3PS — CID 12808687
2-fluoro-2-sulfanylidene-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3,2]dioxaphosphinine (PubChem CID 12808687) has the molecular formula C6H10FO3PS and a molecular weight of 212.18 g/mol. Its IUPAC name is 2-fluoro-2-sulfanylidene-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3,2]dioxaphosphinine.
| Compound Name | 2-fluoro-2-sulfanylidene-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3,2]dioxaphosphinine |
|---|---|
| PubChem CID | 12808687 |
| Molecular Formula | C6H10FO3PS |
| Molecular Weight | 212.18 g/mol |
| Exact Mass | 212.01 |
| IUPAC Name | 2-fluoro-2-sulfanylidene-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3,2]dioxaphosphinine |
| SMILES | FP1(=S)OCC2OCCCC2O1 |
| InChI | InChI=1S/C6H10FO3PS/c7-11(12)9-4-6-5(10-11)2-1-3-8-6/h5-6H,1-4H2 |
| InChIKey | GLHHAUWQHUTCKI-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.18 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|