C7H13O3PS — CID 14055662
(2R,4aR,7aR)-2-methoxy-2-sulfanylidene-4,4a,5,6,7,7a-hexahydrocyclopenta[d][1,3,2]dioxaphosphinine (PubChem CID 14055662) has the molecular formula C7H13O3PS and a molecular weight of 208.22 g/mol. Its IUPAC name is (2R,4aR,7aR)-2-methoxy-2-sulfanylidene-4,4a,5,6,7,7a-hexahydrocyclopenta[d][1,3,2]dioxaphosphinine.
| Compound Name | (2R,4aR,7aR)-2-methoxy-2-sulfanylidene-4,4a,5,6,7,7a-hexahydrocyclopenta[d][1,3,2]dioxaphosphinine |
|---|---|
| PubChem CID | 14055662 |
| Molecular Formula | C7H13O3PS |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.03 |
| IUPAC Name | (2R,4aR,7aR)-2-methoxy-2-sulfanylidene-4,4a,5,6,7,7a-hexahydrocyclopenta[d][1,3,2]dioxaphosphinine |
| SMILES | CO[P@@]1(=S)OC[C@H]2CCC[C@H]2O1 |
| InChI | InChI=1S/C7H13O3PS/c1-8-11(12)9-5-6-3-2-4-7(6)10-11/h6-7H,2-5H2,1H3/t6-,7-,11-/m1/s1 |
| InChIKey | OQSJCRXKXZPETK-OPVBNTEQSA-N |
| XLogP | 2.07 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|