C11H15N2O6PS — CID 88579954
1-[(4aR,6R)-2-methoxy-2-sulfanylidene-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 88579954) has the molecular formula C11H15N2O6PS and a molecular weight of 334.29 g/mol. Its IUPAC name is 1-[(4aR,6R)-2-methoxy-2-sulfanylidene-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(4aR,6R)-2-methoxy-2-sulfanylidene-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 88579954 |
| Molecular Formula | C11H15N2O6PS |
| Molecular Weight | 334.29 g/mol |
| Exact Mass | 334.04 |
| IUPAC Name | 1-[(4aR,6R)-2-methoxy-2-sulfanylidene-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | COP1(=S)OC[C@H]2O[C@@H](n3cc(C)c(=O)[nH]c3=O)CC2O1 |
| InChI | InChI=1S/C11H15N2O6PS/c1-6-4-13(11(15)12-10(6)14)9-3-7-8(18-9)5-17-20(21,16-2)19-7/h4,7-9H,3,5H2,1-2H3,(H,12,14,15)/t7?,8-,9-,20?/m1/s1 |
| InChIKey | YCYFZOMQYRRIEP-PWDFBQGOSA-N |
| XLogP | 0.42 |
| TPSA | 91.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.29 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|