C19H23N2O7P — CID 101454848
1-[(2S,5aR,7R,8aR)-3-ethoxy-3-oxo-2-phenyl-2,5,5a,7,8,8a-hexahydrofuro[3,2-e][1,4,2]dioxaphosphepin-7-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 101454848) has the molecular formula C19H23N2O7P and a molecular weight of 422.37 g/mol. Its IUPAC name is 1-[(2S,5aR,7R,8aR)-3-ethoxy-3-oxo-2-phenyl-2,5,5a,7,8,8a-hexahydrofuro[3,2-e][1,4,2]dioxaphosphepin-7-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2S,5aR,7R,8aR)-3-ethoxy-3-oxo-2-phenyl-2,5,5a,7,8,8a-hexahydrofuro[3,2-e][1,4,2]dioxaphosphepin-7-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 101454848 |
| Molecular Formula | C19H23N2O7P |
| Molecular Weight | 422.37 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | 1-[(2S,5aR,7R,8aR)-3-ethoxy-3-oxo-2-phenyl-2,5,5a,7,8,8a-hexahydrofuro[3,2-e][1,4,2]dioxaphosphepin-7-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | CCOP1(=O)OC[C@H]2O[C@@H](n3cc(C)c(=O)[nH]c3=O)C[C@H]2O[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C19H23N2O7P/c1-3-25-29(24)18(13-7-5-4-6-8-13)28-14-9-16(27-15(14)11-26-29)21-10-12(2)17(22)20-19(21)23/h4-8,10,14-16,18H,3,9,11H2,1-2H3,(H,20,22,23)/t14-,15-,16-,18+,29?/m1/s1 |
| InChIKey | SGCZFAAHXOINBE-APMYTRJDSA-N |
| XLogP | 2.48 |
| TPSA | 108.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.37 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|