C26H29N2O6PS — CID 152793612
1-[(2R,4S,5R)-5-ethyl-4-[[(2R,4R,6R)-2-oxo-4,6-diphenyl-1,3,2λ5-oxathiaphosphinan-2-yl]oxy]oxolan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 152793612) has the molecular formula C26H29N2O6PS and a molecular weight of 528.57 g/mol. Its IUPAC name is 1-[(2R,4S,5R)-5-ethyl-4-[[(2R,4R,6R)-2-oxo-4,6-diphenyl-1,3,2λ5-oxathiaphosphinan-2-yl]oxy]oxolan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,4S,5R)-5-ethyl-4-[[(2R,4R,6R)-2-oxo-4,6-diphenyl-1,3,2λ5-oxathiaphosphinan-2-yl]oxy]oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 152793612 |
| Molecular Formula | C26H29N2O6PS |
| Molecular Weight | 528.57 g/mol |
| Exact Mass | 528.15 |
| IUPAC Name | 1-[(2R,4S,5R)-5-ethyl-4-[[(2R,4R,6R)-2-oxo-4,6-diphenyl-1,3,2λ5-oxathiaphosphinan-2-yl]oxy]oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | CC[C@H]1O[C@@H](n2cc(C)c(=O)[nH]c2=O)C[C@@H]1O[P@@]1(=O)O[C@@H](c2ccccc2)C[C@H](c2ccccc2)S1 |
| InChI | InChI=1S/C26H29N2O6PS/c1-3-20-22(15-24(32-20)28-16-17(2)25(29)27-26(28)30)34-35(31)33-21(18-10-6-4-7-11-18)14-23(36-35)19-12-8-5-9-13-19/h4-13,16,20-24H,3,14-15H2,1-2H3,(H,27,29,30)/t20-,21-,22+,23-,24-,35-/m1/s1 |
| InChIKey | SIQJSQZPNAQPKE-BLVWPCKJSA-N |
| XLogP | 5.67 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.57 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|