C15H20N2O6 — CID 157190315
[2-ethyl-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] prop-2-enyl carbonate (PubChem CID 157190315) has the molecular formula C15H20N2O6 and a molecular weight of 324.33 g/mol. Its IUPAC name is [2-ethyl-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] prop-2-enyl carbonate.
| Compound Name | [2-ethyl-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] prop-2-enyl carbonate |
|---|---|
| PubChem CID | 157190315 |
| Molecular Formula | C15H20N2O6 |
| Molecular Weight | 324.33 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | [2-ethyl-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] prop-2-enyl carbonate |
| SMILES | C=CCOC(=O)OC1CC(n2cc(C)c(=O)[nH]c2=O)OC1CC |
| InChI | InChI=1S/C15H20N2O6/c1-4-6-21-15(20)23-11-7-12(22-10(11)5-2)17-8-9(3)13(18)16-14(17)19/h4,8,10-12H,1,5-7H2,2-3H3,(H,16,18,19) |
| InChIKey | ISTYWDPMYITAAB-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.33 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|