C21H25N2O7PS2 — CID 150999983
[(2R,3S,5R)-2-[[(4S,5R)-4,5-dimethyl-2-sulfanylidene-1,3,2λ5-oxathiaphospholan-2-yl]oxymethyl]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] benzoate (PubChem CID 150999983) has the molecular formula C21H25N2O7PS2 and a molecular weight of 512.55 g/mol. Its IUPAC name is [(2R,3S,5R)-2-[[(4S,5R)-4,5-dimethyl-2-sulfanylidene-1,3,2λ5-oxathiaphospholan-2-yl]oxymethyl]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] benzoate.
| Compound Name | [(2R,3S,5R)-2-[[(4S,5R)-4,5-dimethyl-2-sulfanylidene-1,3,2λ5-oxathiaphospholan-2-yl]oxymethyl]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] benzoate |
|---|---|
| PubChem CID | 150999983 |
| Molecular Formula | C21H25N2O7PS2 |
| Molecular Weight | 512.55 g/mol |
| Exact Mass | 512.08 |
| IUPAC Name | [(2R,3S,5R)-2-[[(4S,5R)-4,5-dimethyl-2-sulfanylidene-1,3,2λ5-oxathiaphospholan-2-yl]oxymethyl]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] benzoate |
| SMILES | Cc1cn([C@H]2C[C@H](OC(=O)c3ccccc3)[C@@H](COP3(=S)O[C@H](C)[C@H](C)S3)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C21H25N2O7PS2/c1-12-10-23(21(26)22-19(12)24)18-9-16(29-20(25)15-7-5-4-6-8-15)17(28-18)11-27-31(32)30-13(2)14(3)33-31/h4-8,10,13-14,16-18H,9,11H2,1-3H3,(H,22,24,26)/t13-,14+,16+,17-,18-,31?/m1/s1 |
| InChIKey | LTXBLTXDPCWJTB-WOBCYYNYSA-N |
| XLogP | 3.14 |
| TPSA | 108.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.55 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|