C22H27N2O6PS2 — CID 149035811
3-benzoyl-1-[(2R,4S,5S)-5-[[(4S,5R)-4,5-dimethyl-2-sulfanylidene-1,3,2λ5-oxathiaphospholan-2-yl]oxymethyl]-4-methyloxolan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 149035811) has the molecular formula C22H27N2O6PS2 and a molecular weight of 510.57 g/mol. Its IUPAC name is 3-benzoyl-1-[(2R,4S,5S)-5-[[(4S,5R)-4,5-dimethyl-2-sulfanylidene-1,3,2λ5-oxathiaphospholan-2-yl]oxymethyl]-4-methyloxolan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 3-benzoyl-1-[(2R,4S,5S)-5-[[(4S,5R)-4,5-dimethyl-2-sulfanylidene-1,3,2λ5-oxathiaphospholan-2-yl]oxymethyl]-4-methyloxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 149035811 |
| Molecular Formula | C22H27N2O6PS2 |
| Molecular Weight | 510.57 g/mol |
| Exact Mass | 510.10 |
| IUPAC Name | 3-benzoyl-1-[(2R,4S,5S)-5-[[(4S,5R)-4,5-dimethyl-2-sulfanylidene-1,3,2λ5-oxathiaphospholan-2-yl]oxymethyl]-4-methyloxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn([C@H]2C[C@H](C)[C@@H](COP3(=S)O[C@H](C)[C@H](C)S3)O2)c(=O)n(C(=O)c2ccccc2)c1=O |
| InChI | InChI=1S/C22H27N2O6PS2/c1-13-10-19(29-18(13)12-28-31(32)30-15(3)16(4)33-31)23-11-14(2)20(25)24(22(23)27)21(26)17-8-6-5-7-9-17/h5-9,11,13,15-16,18-19H,10,12H2,1-4H3/t13-,15+,16-,18+,19+,31?/m0/s1 |
| InChIKey | QGPKOJSZACYACJ-AQQMRPHVSA-N |
| XLogP | 3.71 |
| TPSA | 88.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.57 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|