C25H24N2O6 — CID 11113109
1-[(2R,4aR,7S,8aS)-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]-3-benzoyl-5-methylpyrimidine-2,4-dione (PubChem CID 11113109) has the molecular formula C25H24N2O6 and a molecular weight of 448.48 g/mol. Its IUPAC name is 1-[(2R,4aR,7S,8aS)-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]-3-benzoyl-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,4aR,7S,8aS)-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]-3-benzoyl-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 11113109 |
| Molecular Formula | C25H24N2O6 |
| Molecular Weight | 448.48 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | 1-[(2R,4aR,7S,8aS)-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]-3-benzoyl-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn([C@@H]2CO[C@@H]3CO[C@@H](c4ccccc4)O[C@H]3C2)c(=O)n(C(=O)c2ccccc2)c1=O |
| InChI | InChI=1S/C25H24N2O6/c1-16-13-26(25(30)27(22(16)28)23(29)17-8-4-2-5-9-17)19-12-20-21(31-14-19)15-32-24(33-20)18-10-6-3-7-11-18/h2-11,13,19-21,24H,12,14-15H2,1H3/t19-,20-,21+,24+/m0/s1 |
| InChIKey | KQQRIDHEKSEEML-VMIIQTFKSA-N |
| XLogP | 2.45 |
| TPSA | 88.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.48 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |