C24H21FN2O6 — CID 10389144
1-[(4aR,7S,8aS)-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]-3-benzoyl-5-fluoropyrimidine-2,4-dione (PubChem CID 10389144) has the molecular formula C24H21FN2O6 and a molecular weight of 452.44 g/mol. Its IUPAC name is 1-[(4aR,7S,8aS)-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]-3-benzoyl-5-fluoropyrimidine-2,4-dione.
| Compound Name | 1-[(4aR,7S,8aS)-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]-3-benzoyl-5-fluoropyrimidine-2,4-dione |
|---|---|
| PubChem CID | 10389144 |
| Molecular Formula | C24H21FN2O6 |
| Molecular Weight | 452.44 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | 1-[(4aR,7S,8aS)-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]-3-benzoyl-5-fluoropyrimidine-2,4-dione |
| SMILES | O=C(c1ccccc1)n1c(=O)c(F)cn([C@@H]2CO[C@@H]3COC(c4ccccc4)O[C@H]3C2)c1=O |
| InChI | InChI=1S/C24H21FN2O6/c25-18-12-26(24(30)27(22(18)29)21(28)15-7-3-1-4-8-15)17-11-19-20(31-13-17)14-32-23(33-19)16-9-5-2-6-10-16/h1-10,12,17,19-20,23H,11,13-14H2/t17-,19-,20+,23?/m0/s1 |
| InChIKey | VKZUGBJYBPEYBO-OSENPYSUSA-N |
| XLogP | 2.28 |
| TPSA | 88.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.44 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |