C10H12N2O3Se2 — CID 102084772
1-[(3aR,5R,6aR)-3a,5,6,6a-tetrahydro-3H-diselenolo[4,3-b]furan-5-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 102084772) has the molecular formula C10H12N2O3Se2 and a molecular weight of 366.14 g/mol. Its IUPAC name is 1-[(3aR,5R,6aR)-3a,5,6,6a-tetrahydro-3H-diselenolo[4,3-b]furan-5-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(3aR,5R,6aR)-3a,5,6,6a-tetrahydro-3H-diselenolo[4,3-b]furan-5-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 102084772 |
| Molecular Formula | C10H12N2O3Se2 |
| Molecular Weight | 366.14 g/mol |
| Exact Mass | 367.92 |
| IUPAC Name | 1-[(3aR,5R,6aR)-3a,5,6,6a-tetrahydro-3H-diselenolo[4,3-b]furan-5-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn([C@H]2C[C@H]3[Se][Se]C[C@H]3O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C10H12N2O3Se2/c1-5-3-12(10(14)11-9(5)13)8-2-7-6(15-8)4-16-17-7/h3,6-8H,2,4H2,1H3,(H,11,13,14)/t6-,7-,8-/m1/s1 |
| InChIKey | GGXBWMKNJJKSNM-BWZBUEFSSA-N |
| XLogP | -0.32 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.14 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|