C7H12N2O2 — CID 82838050
4-(oxolan-2-yl)-4,5-dihydro-1,3-oxazol-2-amine (PubChem CID 82838050) has the molecular formula C7H12N2O2 and a molecular weight of 156.18 g/mol. Its IUPAC name is 4-(oxolan-2-yl)-4,5-dihydro-1,3-oxazol-2-amine.
| Compound Name | 4-(oxolan-2-yl)-4,5-dihydro-1,3-oxazol-2-amine |
|---|---|
| PubChem CID | 82838050 |
| Molecular Formula | C7H12N2O2 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.09 |
| IUPAC Name | 4-(oxolan-2-yl)-4,5-dihydro-1,3-oxazol-2-amine |
| SMILES | NC1=NC(C2CCCO2)CO1 |
| InChI | InChI=1S/C7H12N2O2/c8-7-9-5(4-11-7)6-2-1-3-10-6/h5-6H,1-4H2,(H2,8,9) |
| InChIKey | PSDCIPVGLULANO-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |