C5H10N2O — CID 123976121
4-methyl-5,6-dihydro-4H-1,3-oxazin-2-amine (PubChem CID 123976121) has the molecular formula C5H10N2O and a molecular weight of 114.15 g/mol. Its IUPAC name is 4-methyl-5,6-dihydro-4H-1,3-oxazin-2-amine.
| Compound Name | 4-methyl-5,6-dihydro-4H-1,3-oxazin-2-amine |
|---|---|
| PubChem CID | 123976121 |
| Molecular Formula | C5H10N2O |
| Molecular Weight | 114.15 g/mol |
| Exact Mass | 114.08 |
| IUPAC Name | 4-methyl-5,6-dihydro-4H-1,3-oxazin-2-amine |
| SMILES | CC1CCOC(N)=N1 |
| InChI | InChI=1S/C5H10N2O/c1-4-2-3-8-5(6)7-4/h4H,2-3H2,1H3,(H2,6,7) |
| InChIKey | WQPBQHKRPNLRPC-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 114.15 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |