C9H11N3O — CID 89414621
4-pyridin-2-yl-5,6-dihydro-4H-1,3-oxazin-2-amine (PubChem CID 89414621) has the molecular formula C9H11N3O and a molecular weight of 177.21 g/mol. Its IUPAC name is 4-pyridin-2-yl-5,6-dihydro-4H-1,3-oxazin-2-amine.
| Compound Name | 4-pyridin-2-yl-5,6-dihydro-4H-1,3-oxazin-2-amine |
|---|---|
| PubChem CID | 89414621 |
| Molecular Formula | C9H11N3O |
| Molecular Weight | 177.21 g/mol |
| Exact Mass | 177.09 |
| IUPAC Name | 4-pyridin-2-yl-5,6-dihydro-4H-1,3-oxazin-2-amine |
| SMILES | NC1=NC(c2ccccn2)CCO1 |
| InChI | InChI=1S/C9H11N3O/c10-9-12-8(4-6-13-9)7-3-1-2-5-11-7/h1-3,5,8H,4,6H2,(H2,10,12) |
| InChIKey | SWOJGEXAJRUTCJ-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 60.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.21 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |