C7H7N3S — CID 68553246
4-pyridin-2-yl-4,5-dihydrothiadiazole (PubChem CID 68553246) has the molecular formula C7H7N3S and a molecular weight of 165.22 g/mol. Its IUPAC name is 4-pyridin-2-yl-4,5-dihydrothiadiazole.
| Compound Name | 4-pyridin-2-yl-4,5-dihydrothiadiazole |
|---|---|
| PubChem CID | 68553246 |
| Molecular Formula | C7H7N3S |
| Molecular Weight | 165.22 g/mol |
| Exact Mass | 165.04 |
| IUPAC Name | 4-pyridin-2-yl-4,5-dihydrothiadiazole |
| SMILES | c1ccc(C2CSN=N2)nc1 |
| InChI | InChI=1S/C7H7N3S/c1-2-4-8-6(3-1)7-5-11-10-9-7/h1-4,7H,5H2 |
| InChIKey | UODNWALWFHHTPF-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.22 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|