C8H10N2S — CID 92855443
(2R)-2-pyridin-2-yl-1,3-thiazolidine (PubChem CID 92855443) has the molecular formula C8H10N2S and a molecular weight of 166.25 g/mol. Its IUPAC name is (2R)-2-pyridin-2-yl-1,3-thiazolidine.
| Compound Name | (2R)-2-pyridin-2-yl-1,3-thiazolidine |
|---|---|
| PubChem CID | 92855443 |
| Molecular Formula | C8H10N2S |
| Molecular Weight | 166.25 g/mol |
| Exact Mass | 166.06 |
| IUPAC Name | (2R)-2-pyridin-2-yl-1,3-thiazolidine |
| SMILES | c1ccc([C@@H]2NCCS2)nc1 |
| InChI | InChI=1S/C8H10N2S/c1-2-4-9-7(3-1)8-10-5-6-11-8/h1-4,8,10H,5-6H2/t8-/m1/s1 |
| InChIKey | VQRXHIVVUXYAFH-MRVPVSSYSA-N |
| XLogP | 1.42 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.25 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |