About 2-pyridin-2-ylpiperazine;dihydrochloride
2-pyridin-2-ylpiperazine;dihydrochloride (PubChem CID 21151674) has the molecular formula C9H15Cl2N3
and a molecular weight of 236.15 g/mol. Its IUPAC name is 2-pyridin-2-ylpiperazine;dihydrochloride.
Molecular Properties
| Compound Name | 2-pyridin-2-ylpiperazine;dihydrochloride |
| PubChem CID | 21151674 |
| Molecular Formula | C9H15Cl2N3 |
| Molecular Weight | 236.15 g/mol |
| Exact Mass | 235.06 |
| IUPAC Name | 2-pyridin-2-ylpiperazine;dihydrochloride |
| SMILES | Cl.Cl.c1ccc(C2CNCCN2)nc1 |
| InChI | InChI=1S/C9H13N3.2ClH/c1-2-4-11-8(3-1)9-7-10-5-6-12-9;;/h1-4,9-10,12H,5-7H2;2*1H |
| InChIKey | VJJABUBRAPVOMT-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.15 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-pyridin-2-ylpiperazine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyridin-2-ylpiperazine;dihydrochloride?
The IUPAC name of 2-pyridin-2-ylpiperazine;dihydrochloride (CID 21151674) is 2-pyridin-2-ylpiperazine;dihydrochloride.
What is the SMILES notation for 2-pyridin-2-ylpiperazine;dihydrochloride?
The canonical SMILES for 2-pyridin-2-ylpiperazine;dihydrochloride is Cl.Cl.c1ccc(C2CNCCN2)nc1.
What is the InChIKey of 2-pyridin-2-ylpiperazine;dihydrochloride?
The InChIKey is VJJABUBRAPVOMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3.2ClH/c1-2-4-11-8(3-1)9-7-10-5-6-12-9;;/h1-4,9-10,12H,5-7H2;2*1H.
What are the key properties of 2-pyridin-2-ylpiperazine;dihydrochloride?
2-pyridin-2-ylpiperazine;dihydrochloride has a molecular weight of 236.15 g/mol, XLogP of 1.16, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyridin-2-ylpiperazine;dihydrochloride is sourced from PubChem (CID 21151674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).