C10H14N2 — CID 67133523
cis-(1R,3S)-3-pyridin-2-ylcyclopentan-1-amine (PubChem CID 67133523) has the molecular formula C10H14N2 and a molecular weight of 162.24 g/mol. Its IUPAC name is cis-(1R,3S)-3-pyridin-2-ylcyclopentan-1-amine.
| Compound Name | cis-(1R,3S)-3-pyridin-2-ylcyclopentan-1-amine |
|---|---|
| PubChem CID | 67133523 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | cis-(1R,3S)-3-pyridin-2-ylcyclopentan-1-amine |
| SMILES | N[C@@H]1CC[C@H](c2ccccn2)C1 |
| InChI | InChI=1S/C10H14N2/c11-9-5-4-8(7-9)10-3-1-2-6-12-10/h1-3,6,8-9H,4-5,7,11H2/t8-,9+/m0/s1 |
| InChIKey | QSLNBCQMYVTELX-DTWKUNHWSA-N |
| XLogP | 1.68 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |