C14H21N3 — CID 150395237
4-N-[(1S,2R)-2-pyridin-2-ylcyclopropyl]cyclohexane-1,4-diamine (PubChem CID 150395237) has the molecular formula C14H21N3 and a molecular weight of 231.34 g/mol. Its IUPAC name is 4-N-[(1S,2R)-2-pyridin-2-ylcyclopropyl]cyclohexane-1,4-diamine.
| Compound Name | 4-N-[(1S,2R)-2-pyridin-2-ylcyclopropyl]cyclohexane-1,4-diamine |
|---|---|
| PubChem CID | 150395237 |
| Molecular Formula | C14H21N3 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.17 |
| IUPAC Name | 4-N-[(1S,2R)-2-pyridin-2-ylcyclopropyl]cyclohexane-1,4-diamine |
| SMILES | NC1CCC(N[C@H]2C[C@H]2c2ccccn2)CC1 |
| InChI | InChI=1S/C14H21N3/c15-10-4-6-11(7-5-10)17-14-9-12(14)13-3-1-2-8-16-13/h1-3,8,10-12,14,17H,4-7,9,15H2/t10?,11?,12-,14-/m0/s1 |
| InChIKey | HCORYGQWVSWIOL-BUCSNLDVSA-N |
| XLogP | 1.80 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |