C10H17ClN4 — CID 71643877
4-N-pyrimidin-2-ylcyclohexane-1,4-diamine;hydrochloride (PubChem CID 71643877) has the molecular formula C10H17ClN4 and a molecular weight of 228.73 g/mol. Its IUPAC name is 4-N-pyrimidin-2-ylcyclohexane-1,4-diamine;hydrochloride.
| Compound Name | 4-N-pyrimidin-2-ylcyclohexane-1,4-diamine;hydrochloride |
|---|---|
| PubChem CID | 71643877 |
| Molecular Formula | C10H17ClN4 |
| Molecular Weight | 228.73 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | 4-N-pyrimidin-2-ylcyclohexane-1,4-diamine;hydrochloride |
| SMILES | Cl.NC1CCC(Nc2ncccn2)CC1 |
| InChI | InChI=1S/C10H16N4.ClH/c11-8-2-4-9(5-3-8)14-10-12-6-1-7-13-10;/h1,6-9H,2-5,11H2,(H,12,13,14);1H |
| InChIKey | OBUCBGNHAVKMKN-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.73 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |