C12H21N3O — CID 144986361
N-(oxan-4-yl)pyrimidin-2-amine;propane (PubChem CID 144986361) has the molecular formula C12H21N3O and a molecular weight of 223.32 g/mol. Its IUPAC name is N-(oxan-4-yl)pyrimidin-2-amine;propane.
| Compound Name | N-(oxan-4-yl)pyrimidin-2-amine;propane |
|---|---|
| PubChem CID | 144986361 |
| Molecular Formula | C12H21N3O |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.17 |
| IUPAC Name | N-(oxan-4-yl)pyrimidin-2-amine;propane |
| SMILES | CCC.c1cnc(NC2CCOCC2)nc1 |
| InChI | InChI=1S/C9H13N3O.C3H8/c1-4-10-9(11-5-1)12-8-2-6-13-7-3-8;1-3-2/h1,4-5,8H,2-3,6-7H2,(H,10,11,12);3H2,1-2H3 |
| InChIKey | JHQOHVFOGBXTPA-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |