C15H24N4O3S — CID 98894497
(4R)-9-ethylsulfonyl-N-pyrimidin-2-yl-1-oxa-9-azaspiro[5.5]undecan-4-amine (PubChem CID 98894497) has the molecular formula C15H24N4O3S and a molecular weight of 340.45 g/mol. Its IUPAC name is (4R)-9-ethylsulfonyl-N-pyrimidin-2-yl-1-oxa-9-azaspiro[5.5]undecan-4-amine.
| Compound Name | (4R)-9-ethylsulfonyl-N-pyrimidin-2-yl-1-oxa-9-azaspiro[5.5]undecan-4-amine |
|---|---|
| PubChem CID | 98894497 |
| Molecular Formula | C15H24N4O3S |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | (4R)-9-ethylsulfonyl-N-pyrimidin-2-yl-1-oxa-9-azaspiro[5.5]undecan-4-amine |
| SMILES | CCS(=O)(=O)N1CCC2(CC1)C[C@H](Nc1ncccn1)CCO2 |
| InChI | InChI=1S/C15H24N4O3S/c1-2-23(20,21)19-9-5-15(6-10-19)12-13(4-11-22-15)18-14-16-7-3-8-17-14/h3,7-8,13H,2,4-6,9-12H2,1H3,(H,16,17,18)/t13-/m1/s1 |
| InChIKey | XLXAYHRJNJOOLQ-CYBMUJFWSA-N |
| XLogP | 1.25 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |