C18H22N4O2S — CID 98895872
[(4R)-4-(pyrimidin-2-ylamino)-1-oxa-9-azaspiro[5.5]undecan-9-yl]-thiophen-2-ylmethanone (PubChem CID 98895872) has the molecular formula C18H22N4O2S and a molecular weight of 358.47 g/mol. Its IUPAC name is [(4R)-4-(pyrimidin-2-ylamino)-1-oxa-9-azaspiro[5.5]undecan-9-yl]-thiophen-2-ylmethanone.
| Compound Name | [(4R)-4-(pyrimidin-2-ylamino)-1-oxa-9-azaspiro[5.5]undecan-9-yl]-thiophen-2-ylmethanone |
|---|---|
| PubChem CID | 98895872 |
| Molecular Formula | C18H22N4O2S |
| Molecular Weight | 358.47 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | [(4R)-4-(pyrimidin-2-ylamino)-1-oxa-9-azaspiro[5.5]undecan-9-yl]-thiophen-2-ylmethanone |
| SMILES | O=C(c1cccs1)N1CCC2(CC1)C[C@H](Nc1ncccn1)CCO2 |
| InChI | InChI=1S/C18H22N4O2S/c23-16(15-3-1-12-25-15)22-9-5-18(6-10-22)13-14(4-11-24-18)21-17-19-7-2-8-20-17/h1-3,7-8,12,14H,4-6,9-11,13H2,(H,19,20,21)/t14-/m1/s1 |
| InChIKey | QRKIAUJFBZIFBX-CQSZACIVSA-N |
| XLogP | 2.80 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.47 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |