C18H24N4O2 — CID 98895334
(4R)-9-(furan-2-ylmethyl)-N-pyrimidin-2-yl-1-oxa-9-azaspiro[5.5]undecan-4-amine (PubChem CID 98895334) has the molecular formula C18H24N4O2 and a molecular weight of 328.42 g/mol. Its IUPAC name is (4R)-9-(furan-2-ylmethyl)-N-pyrimidin-2-yl-1-oxa-9-azaspiro[5.5]undecan-4-amine.
| Compound Name | (4R)-9-(furan-2-ylmethyl)-N-pyrimidin-2-yl-1-oxa-9-azaspiro[5.5]undecan-4-amine |
|---|---|
| PubChem CID | 98895334 |
| Molecular Formula | C18H24N4O2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | (4R)-9-(furan-2-ylmethyl)-N-pyrimidin-2-yl-1-oxa-9-azaspiro[5.5]undecan-4-amine |
| SMILES | c1cnc(N[C@@H]2CCOC3(CCN(Cc4ccco4)CC3)C2)nc1 |
| InChI | InChI=1S/C18H24N4O2/c1-3-16(23-11-1)14-22-9-5-18(6-10-22)13-15(4-12-24-18)21-17-19-7-2-8-20-17/h1-3,7-8,11,15H,4-6,9-10,12-14H2,(H,19,20,21)/t15-/m1/s1 |
| InChIKey | ANRUMQLGRPMGTB-OAHLLOKOSA-N |
| XLogP | 2.70 |
| TPSA | 63.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |