C8H11N3O — CID 175803601
N-[(3S)-oxolan-3-yl]pyrimidin-2-amine (PubChem CID 175803601) has the molecular formula C8H11N3O and a molecular weight of 165.20 g/mol. Its IUPAC name is N-[(3S)-oxolan-3-yl]pyrimidin-2-amine.
| Compound Name | N-[(3S)-oxolan-3-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 175803601 |
| Molecular Formula | C8H11N3O |
| Molecular Weight | 165.20 g/mol |
| Exact Mass | 165.09 |
| IUPAC Name | N-[(3S)-oxolan-3-yl]pyrimidin-2-amine |
| SMILES | c1cnc(N[C@H]2CCOC2)nc1 |
| InChI | InChI=1S/C8H11N3O/c1-3-9-8(10-4-1)11-7-2-5-12-6-7/h1,3-4,7H,2,5-6H2,(H,9,10,11)/t7-/m0/s1 |
| InChIKey | DFJWNRCGAPPNDC-ZETCQYMHSA-N |
| XLogP | 0.68 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.20 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |