C11H14F3N3O — CID 95558339
N-[(3R)-oxolan-3-yl]-4-(3,3,3-trifluoropropyl)pyrimidin-2-amine (PubChem CID 95558339) has the molecular formula C11H14F3N3O and a molecular weight of 261.25 g/mol. Its IUPAC name is N-[(3R)-oxolan-3-yl]-4-(3,3,3-trifluoropropyl)pyrimidin-2-amine.
| Compound Name | N-[(3R)-oxolan-3-yl]-4-(3,3,3-trifluoropropyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 95558339 |
| Molecular Formula | C11H14F3N3O |
| Molecular Weight | 261.25 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | N-[(3R)-oxolan-3-yl]-4-(3,3,3-trifluoropropyl)pyrimidin-2-amine |
| SMILES | FC(F)(F)CCc1ccnc(N[C@@H]2CCOC2)n1 |
| InChI | InChI=1S/C11H14F3N3O/c12-11(13,14)4-1-8-2-5-15-10(16-8)17-9-3-6-18-7-9/h2,5,9H,1,3-4,6-7H2,(H,15,16,17)/t9-/m1/s1 |
| InChIKey | LQORODBHQFBGGX-SECBINFHSA-N |
| XLogP | 2.17 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.25 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |