C12H19N5O — CID 76709052
4-(3-aminopyrrolidin-1-yl)-N-(oxolan-3-yl)pyrimidin-2-amine (PubChem CID 76709052) has the molecular formula C12H19N5O and a molecular weight of 249.32 g/mol. Its IUPAC name is 4-(3-aminopyrrolidin-1-yl)-N-(oxolan-3-yl)pyrimidin-2-amine.
| Compound Name | 4-(3-aminopyrrolidin-1-yl)-N-(oxolan-3-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 76709052 |
| Molecular Formula | C12H19N5O |
| Molecular Weight | 249.32 g/mol |
| Exact Mass | 249.16 |
| IUPAC Name | 4-(3-aminopyrrolidin-1-yl)-N-(oxolan-3-yl)pyrimidin-2-amine |
| SMILES | NC1CCN(c2ccnc(NC3CCOC3)n2)C1 |
| InChI | InChI=1S/C12H19N5O/c13-9-2-5-17(7-9)11-1-4-14-12(16-11)15-10-3-6-18-8-10/h1,4,9-10H,2-3,5-8,13H2,(H,14,15,16) |
| InChIKey | AKIGRHATLPZWFK-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 76.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.32 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |