C8H11ClN4 — CID 71643947
(3S)-1-(2-chloropyrimidin-4-yl)pyrrolidin-3-amine (PubChem CID 71643947) has the molecular formula C8H11ClN4 and a molecular weight of 198.66 g/mol. Its IUPAC name is (3S)-1-(2-chloropyrimidin-4-yl)pyrrolidin-3-amine.
| Compound Name | (3S)-1-(2-chloropyrimidin-4-yl)pyrrolidin-3-amine |
|---|---|
| PubChem CID | 71643947 |
| Molecular Formula | C8H11ClN4 |
| Molecular Weight | 198.66 g/mol |
| Exact Mass | 198.07 |
| IUPAC Name | (3S)-1-(2-chloropyrimidin-4-yl)pyrrolidin-3-amine |
| SMILES | N[C@H]1CCN(c2ccnc(Cl)n2)C1 |
| InChI | InChI=1S/C8H11ClN4/c9-8-11-3-1-7(12-8)13-4-2-6(10)5-13/h1,3,6H,2,4-5,10H2/t6-/m0/s1 |
| InChIKey | HOMJACHULQDJAF-LURJTMIESA-N |
| XLogP | 0.67 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.66 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |