C16H18N4O — CID 129086091
4-(2,3-dihydroindol-1-yl)-N-[(3R)-oxolan-3-yl]pyrimidin-2-amine (PubChem CID 129086091) has the molecular formula C16H18N4O and a molecular weight of 282.35 g/mol. Its IUPAC name is 4-(2,3-dihydroindol-1-yl)-N-[(3R)-oxolan-3-yl]pyrimidin-2-amine.
| Compound Name | 4-(2,3-dihydroindol-1-yl)-N-[(3R)-oxolan-3-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 129086091 |
| Molecular Formula | C16H18N4O |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 4-(2,3-dihydroindol-1-yl)-N-[(3R)-oxolan-3-yl]pyrimidin-2-amine |
| SMILES | c1ccc2c(c1)CCN2c1ccnc(N[C@@H]2CCOC2)n1 |
| InChI | InChI=1S/C16H18N4O/c1-2-4-14-12(3-1)6-9-20(14)15-5-8-17-16(19-15)18-13-7-10-21-11-13/h1-5,8,13H,6-7,9-11H2,(H,17,18,19)/t13-/m1/s1 |
| InChIKey | GGYMTQQHZDLLOE-CYBMUJFWSA-N |
| XLogP | 2.37 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |