C9H12FN3O — CID 127015469
5-fluoro-N-[(3R)-oxan-3-yl]pyrimidin-2-amine (PubChem CID 127015469) has the molecular formula C9H12FN3O and a molecular weight of 197.21 g/mol. Its IUPAC name is 5-fluoro-N-[(3R)-oxan-3-yl]pyrimidin-2-amine.
| Compound Name | 5-fluoro-N-[(3R)-oxan-3-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 127015469 |
| Molecular Formula | C9H12FN3O |
| Molecular Weight | 197.21 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | 5-fluoro-N-[(3R)-oxan-3-yl]pyrimidin-2-amine |
| SMILES | Fc1cnc(N[C@@H]2CCCOC2)nc1 |
| InChI | InChI=1S/C9H12FN3O/c10-7-4-11-9(12-5-7)13-8-2-1-3-14-6-8/h4-5,8H,1-3,6H2,(H,11,12,13)/t8-/m1/s1 |
| InChIKey | OOMANQOTILQPQH-MRVPVSSYSA-N |
| XLogP | 1.21 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.21 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |