C10H12ClFN2O — CID 79727736
5-chloro-3-fluoro-N-(oxan-3-yl)pyridin-2-amine (PubChem CID 79727736) has the molecular formula C10H12ClFN2O and a molecular weight of 230.67 g/mol. Its IUPAC name is 5-chloro-3-fluoro-N-(oxan-3-yl)pyridin-2-amine.
| Compound Name | 5-chloro-3-fluoro-N-(oxan-3-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 79727736 |
| Molecular Formula | C10H12ClFN2O |
| Molecular Weight | 230.67 g/mol |
| Exact Mass | 230.06 |
| IUPAC Name | 5-chloro-3-fluoro-N-(oxan-3-yl)pyridin-2-amine |
| SMILES | Fc1cc(Cl)cnc1NC1CCCOC1 |
| InChI | InChI=1S/C10H12ClFN2O/c11-7-4-9(12)10(13-5-7)14-8-2-1-3-15-6-8/h4-5,8H,1-3,6H2,(H,13,14) |
| InChIKey | CSIVEYGNTUDMNV-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.67 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |