C9H10ClFN2 — CID 79727841
5-chloro-N-cyclobutyl-3-fluoropyridin-2-amine (PubChem CID 79727841) has the molecular formula C9H10ClFN2 and a molecular weight of 200.64 g/mol. Its IUPAC name is 5-chloro-N-cyclobutyl-3-fluoropyridin-2-amine.
| Compound Name | 5-chloro-N-cyclobutyl-3-fluoropyridin-2-amine |
|---|---|
| PubChem CID | 79727841 |
| Molecular Formula | C9H10ClFN2 |
| Molecular Weight | 200.64 g/mol |
| Exact Mass | 200.05 |
| IUPAC Name | 5-chloro-N-cyclobutyl-3-fluoropyridin-2-amine |
| SMILES | Fc1cc(Cl)cnc1NC1CCC1 |
| InChI | InChI=1S/C9H10ClFN2/c10-6-4-8(11)9(12-5-6)13-7-2-1-3-7/h4-5,7H,1-3H2,(H,12,13) |
| InChIKey | MTPSJYPLHWSNKP-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.64 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |