About trans-(1R,2R)-2-N-(5-chloro-3-fluoro-2-pyridinyl)cyclohexane-1,2-diamine
trans-(1R,2R)-2-N-(5-chloro-3-fluoro-2-pyridinyl)cyclohexane-1,2-diamine (PubChem CID 102738799) has the molecular formula C11H15ClFN3
and a molecular weight of 243.71 g/mol. Its IUPAC name is trans-(1R,2R)-2-N-(5-chloro-3-fluoro-2-pyridinyl)cyclohexane-1,2-diamine.
Molecular Properties
| Compound Name | trans-(1R,2R)-2-N-(5-chloro-3-fluoro-2-pyridinyl)cyclohexane-1,2-diamine |
| PubChem CID | 102738799 |
| Molecular Formula | C11H15ClFN3 |
| Molecular Weight | 243.71 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | trans-(1R,2R)-2-N-(5-chloro-3-fluoro-2-pyridinyl)cyclohexane-1,2-diamine |
| SMILES | N[C@@H]1CCCC[C@H]1Nc1ncc(Cl)cc1F |
| InChI | InChI=1S/C11H15ClFN3/c12-7-5-8(13)11(15-6-7)16-10-4-2-1-3-9(10)14/h5-6,9-10H,1-4,14H2,(H,15,16)/t9-,10-/m1/s1 |
| InChIKey | SQEDBTBEZVXDAV-NXEZZACHSA-N |
| XLogP | 2.56 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.71 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze trans-(1R,2R)-2-N-(5-chloro-3-fluoro-2-pyridinyl)cyclohexane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(1R,2R)-2-N-(5-chloro-3-fluoro-2-pyridinyl)cyclohexane-1,2-diamine?
The IUPAC name of trans-(1R,2R)-2-N-(5-chloro-3-fluoro-2-pyridinyl)cyclohexane-1,2-diamine (CID 102738799) is trans-(1R,2R)-2-N-(5-chloro-3-fluoro-2-pyridinyl)cyclohexane-1,2-diamine.
What is the SMILES notation for trans-(1R,2R)-2-N-(5-chloro-3-fluoro-2-pyridinyl)cyclohexane-1,2-diamine?
The canonical SMILES for trans-(1R,2R)-2-N-(5-chloro-3-fluoro-2-pyridinyl)cyclohexane-1,2-diamine is N[C@@H]1CCCC[C@H]1Nc1ncc(Cl)cc1F.
What is the InChIKey of trans-(1R,2R)-2-N-(5-chloro-3-fluoro-2-pyridinyl)cyclohexane-1,2-diamine?
The InChIKey is SQEDBTBEZVXDAV-NXEZZACHSA-N. The full InChI is InChI=1S/C11H15ClFN3/c12-7-5-8(13)11(15-6-7)16-10-4-2-1-3-9(10)14/h5-6,9-10H,1-4,14H2,(H,15,16)/t9-,10-/m1/s1.
What are the key properties of trans-(1R,2R)-2-N-(5-chloro-3-fluoro-2-pyridinyl)cyclohexane-1,2-diamine?
trans-(1R,2R)-2-N-(5-chloro-3-fluoro-2-pyridinyl)cyclohexane-1,2-diamine has a molecular weight of 243.71 g/mol, XLogP of 2.56, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1R,2R)-2-N-(5-chloro-3-fluoro-2-pyridinyl)cyclohexane-1,2-diamine is sourced from PubChem (CID 102738799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).