C10H12ClFN2 — CID 130556137
5-chloro-3-fluoro-N-(2-methylcyclobutyl)pyridin-2-amine (PubChem CID 130556137) has the molecular formula C10H12ClFN2 and a molecular weight of 214.67 g/mol. Its IUPAC name is 5-chloro-3-fluoro-N-(2-methylcyclobutyl)pyridin-2-amine.
| Compound Name | 5-chloro-3-fluoro-N-(2-methylcyclobutyl)pyridin-2-amine |
|---|---|
| PubChem CID | 130556137 |
| Molecular Formula | C10H12ClFN2 |
| Molecular Weight | 214.67 g/mol |
| Exact Mass | 214.07 |
| IUPAC Name | 5-chloro-3-fluoro-N-(2-methylcyclobutyl)pyridin-2-amine |
| SMILES | CC1CCC1Nc1ncc(Cl)cc1F |
| InChI | InChI=1S/C10H12ClFN2/c1-6-2-3-9(6)14-10-8(12)4-7(11)5-13-10/h4-6,9H,2-3H2,1H3,(H,13,14) |
| InChIKey | CYEXGENMTKYUEZ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.67 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |