C10H11FN2O3 — CID 167971128
5-fluoro-6-[[(3R)-oxolan-3-yl]amino]pyridine-3-carboxylic acid (PubChem CID 167971128) has the molecular formula C10H11FN2O3 and a molecular weight of 226.21 g/mol. Its IUPAC name is 5-fluoro-6-[[(3R)-oxolan-3-yl]amino]pyridine-3-carboxylic acid.
| Compound Name | 5-fluoro-6-[[(3R)-oxolan-3-yl]amino]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 167971128 |
| Molecular Formula | C10H11FN2O3 |
| Molecular Weight | 226.21 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | 5-fluoro-6-[[(3R)-oxolan-3-yl]amino]pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cnc(N[C@@H]2CCOC2)c(F)c1 |
| InChI | InChI=1S/C10H11FN2O3/c11-8-3-6(10(14)15)4-12-9(8)13-7-1-2-16-5-7/h3-4,7H,1-2,5H2,(H,12,13)(H,14,15)/t7-/m1/s1 |
| InChIKey | AAHGFYCWNLHPBT-SSDOTTSWSA-N |
| XLogP | 1.12 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.21 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |