C9H12BrN3O — CID 80716678
3-bromo-2-N-(oxolan-3-yl)pyridine-2,5-diamine (PubChem CID 80716678) has the molecular formula C9H12BrN3O and a molecular weight of 258.12 g/mol. Its IUPAC name is 3-bromo-2-N-(oxolan-3-yl)pyridine-2,5-diamine.
| Compound Name | 3-bromo-2-N-(oxolan-3-yl)pyridine-2,5-diamine |
|---|---|
| PubChem CID | 80716678 |
| Molecular Formula | C9H12BrN3O |
| Molecular Weight | 258.12 g/mol |
| Exact Mass | 257.02 |
| IUPAC Name | 3-bromo-2-N-(oxolan-3-yl)pyridine-2,5-diamine |
| SMILES | Nc1cnc(NC2CCOC2)c(Br)c1 |
| InChI | InChI=1S/C9H12BrN3O/c10-8-3-6(11)4-12-9(8)13-7-1-2-14-5-7/h3-4,7H,1-2,5,11H2,(H,12,13) |
| InChIKey | XQHJHXQFFLROLE-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.12 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |